C21H31N5O6 — CID 59869869
CID 59869869 (PubChem CID 59869869) has the molecular formula C21H31N5O6 and a molecular weight of 449.51 g/mol.
| Compound Name | CID 59869869 |
|---|---|
| PubChem CID | 59869869 |
| Molecular Formula | C21H31N5O6 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | — |
| SMILES | [C]=C(N)NCCC[C@H]1C(=O)N(C(=O)N2CCN(C(=O)OC3CCCCC3)CC2)C1C(=O)O |
| InChI | InChI=1S/C21H31N5O6/c1-14(22)23-9-5-8-16-17(19(28)29)26(18(16)27)20(30)24-10-12-25(13-11-24)21(31)32-15-6-3-2-4-7-15/h15-17,23H,2-13,22H2,(H,28,29)/t16-,17?/m1/s1 |
| InChIKey | WOVGHKMLOFWKJJ-TZHYSIJRSA-N |
| XLogP | 0.58 |
| TPSA | 145.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|