C15H16N2O3S2Y-2 — CID 59870130
benzoylazanide;2-methyl-N-(sulfanylmethyl)benzene-5-ide-1-sulfonamide;yttrium (PubChem CID 59870130) has the molecular formula C15H16N2O3S2Y-2 and a molecular weight of 425.34 g/mol. Its IUPAC name is benzoylazanide;2-methyl-N-(sulfanylmethyl)benzene-5-ide-1-sulfonamide;yttrium.
| Compound Name | benzoylazanide;2-methyl-N-(sulfanylmethyl)benzene-5-ide-1-sulfonamide;yttrium |
|---|---|
| PubChem CID | 59870130 |
| Molecular Formula | C15H16N2O3S2Y-2 |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 424.97 |
| IUPAC Name | benzoylazanide;2-methyl-N-(sulfanylmethyl)benzene-5-ide-1-sulfonamide;yttrium |
| SMILES | Cc1cc[c-]cc1S(=O)(=O)NCS.[NH-]C(=O)c1ccccc1.[Y] |
| InChI | InChI=1S/C8H10NO2S2.C7H7NO.Y/c1-7-4-2-3-5-8(7)13(10,11)9-6-12;8-7(9)6-4-2-1-3-5-6;/h2,4-5,9,12H,6H2,1H3;1-5H,(H2,8,9);/q-1;;/p-1 |
| InChIKey | CHVWRQNRYMYZGV-UHFFFAOYSA-M |
| XLogP | 2.84 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|