About benzoylazanide;samarium
benzoylazanide;samarium (PubChem CID 87733393) has the molecular formula C14H12N2O2Sm-2
and a molecular weight of 390.62 g/mol. Its IUPAC name is benzoylazanide;samarium.
Molecular Properties
| Compound Name | benzoylazanide;samarium |
| PubChem CID | 87733393 |
| Molecular Formula | C14H12N2O2Sm-2 |
| Molecular Weight | 390.62 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | benzoylazanide;samarium |
| SMILES | [NH-]C(=O)c1ccccc1.[NH-]C(=O)c1ccccc1.[Sm] |
| InChI | InChI=1S/2C7H7NO.Sm/c2*8-7(9)6-4-2-1-3-5-6;/h2*1-5H,(H2,8,9);/p-2 |
| InChIKey | YIAFCZFOAAESAF-UHFFFAOYSA-L |
| XLogP | 3.76 |
| TPSA | 81.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.62 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzoylazanide;samarium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoylazanide;samarium?
The IUPAC name of benzoylazanide;samarium (CID 87733393) is benzoylazanide;samarium.
What is the SMILES notation for benzoylazanide;samarium?
The canonical SMILES for benzoylazanide;samarium is [NH-]C(=O)c1ccccc1.[NH-]C(=O)c1ccccc1.[Sm].
What is the InChIKey of benzoylazanide;samarium?
The InChIKey is YIAFCZFOAAESAF-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H7NO.Sm/c2*8-7(9)6-4-2-1-3-5-6;/h2*1-5H,(H2,8,9);/p-2.
What are the key properties of benzoylazanide;samarium?
benzoylazanide;samarium has a molecular weight of 390.62 g/mol, XLogP of 3.76, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzoylazanide;samarium is sourced from PubChem (CID 87733393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).