C28H34 — CID 59872093
1-but-1-ynyl-4-[2-(4-ethyl-2,3,5,6-tetramethylphenyl)ethynyl]-2,3,5,6-tetramethylbenzene (PubChem CID 59872093) has the molecular formula C28H34 and a molecular weight of 370.58 g/mol. Its IUPAC name is 1-but-1-ynyl-4-[2-(4-ethyl-2,3,5,6-tetramethylphenyl)ethynyl]-2,3,5,6-tetramethylbenzene.
| Compound Name | 1-but-1-ynyl-4-[2-(4-ethyl-2,3,5,6-tetramethylphenyl)ethynyl]-2,3,5,6-tetramethylbenzene |
|---|---|
| PubChem CID | 59872093 |
| Molecular Formula | C28H34 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | 1-but-1-ynyl-4-[2-(4-ethyl-2,3,5,6-tetramethylphenyl)ethynyl]-2,3,5,6-tetramethylbenzene |
| SMILES | CCC#Cc1c(C)c(C)c(C#Cc2c(C)c(C)c(CC)c(C)c2C)c(C)c1C |
| InChI | InChI=1S/C28H34/c1-11-13-14-26-21(7)23(9)28(24(10)22(26)8)16-15-27-19(5)17(3)25(12-2)18(4)20(27)6/h11-12H2,1-10H3 |
| InChIKey | GQQNSTNYANCXIW-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|