C32H52Si — CID 59873930
dimethyl-(1,2,3,4,5,6,7,8-octamethyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-[(3R,4S)-2,3,4,5-tetramethylcyclopentyl]silane (PubChem CID 59873930) has the molecular formula C32H52Si and a molecular weight of 464.85 g/mol. Its IUPAC name is dimethyl-(1,2,3,4,5,6,7,8-octamethyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-[(3R,4S)-2,3,4,5-tetramethylcyclopentyl]silane.
| Compound Name | dimethyl-(1,2,3,4,5,6,7,8-octamethyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-[(3R,4S)-2,3,4,5-tetramethylcyclopentyl]silane |
|---|---|
| PubChem CID | 59873930 |
| Molecular Formula | C32H52Si |
| Molecular Weight | 464.85 g/mol |
| Exact Mass | 464.38 |
| IUPAC Name | dimethyl-(1,2,3,4,5,6,7,8-octamethyl-4b,8a,9,9a-tetrahydro-4aH-fluoren-9-yl)-[(3R,4S)-2,3,4,5-tetramethylcyclopentyl]silane |
| SMILES | CC1=C(C)C2C3C(C)=C(C)C(C)=C(C)C3C([Si](C)(C)C3C(C)[C@@H](C)[C@@H](C)C3C)C2C(C)=C1C |
| InChI | InChI=1S/C32H52Si/c1-15-17(3)23(9)29-27(21(15)7)28-22(8)16(2)18(4)24(10)30(28)32(29)33(13,14)31-25(11)19(5)20(6)26(31)12/h19-20,25-32H,1-14H3/t19-,20+,25?,26?,27?,28?,29?,30?,31?,32? |
| InChIKey | HFUAGDNJYXQBDR-YHSHWONXSA-N |
| XLogP | 9.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.85 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|