C42H32F6O7S2 — CID 59873948
1-ethyl-4-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-methoxyphenyl)sulfonylphenoxy]phenyl]propan-2-yl]phenoxy]phenyl]sulfonylbenzene (PubChem CID 59873948) has the molecular formula C42H32F6O7S2 and a molecular weight of 826.83 g/mol. Its IUPAC name is 1-ethyl-4-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-methoxyphenyl)sulfonylphenoxy]phenyl]propan-2-yl]phenoxy]phenyl]sulfonylbenzene.
| Compound Name | 1-ethyl-4-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-methoxyphenyl)sulfonylphenoxy]phenyl]propan-2-yl]phenoxy]phenyl]sulfonylbenzene |
|---|---|
| PubChem CID | 59873948 |
| Molecular Formula | C42H32F6O7S2 |
| Molecular Weight | 826.83 g/mol |
| Exact Mass | 826.15 |
| IUPAC Name | 1-ethyl-4-[4-[4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-methoxyphenyl)sulfonylphenoxy]phenyl]propan-2-yl]phenoxy]phenyl]sulfonylbenzene |
| SMILES | CCc1ccc(S(=O)(=O)c2ccc(Oc3ccc(C(c4ccc(Oc5ccc(S(=O)(=O)c6ccc(OC)cc6)cc5)cc4)(C(F)(F)F)C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C42H32F6O7S2/c1-3-28-4-20-36(21-5-28)56(49,50)38-24-16-34(17-25-38)54-32-10-6-29(7-11-32)40(41(43,44)45,42(46,47)48)30-8-12-33(13-9-30)55-35-18-26-39(27-19-35)57(51,52)37-22-14-31(53-2)15-23-37/h4-27H,3H2,1-2H3 |
| InChIKey | YIFHNGRBFCVMHA-UHFFFAOYSA-N |
| XLogP | 10.92 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.83 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |