C33H22ClF9O5S — CID 18739174
4-[1,2,2,3,3,4-hexafluoro-4-[4-[1-(4-methylphenyl)-1-[4-(1,2,2-trifluoroethenoxy)phenyl]ethyl]phenoxy]cyclobutyl]oxybenzenesulfonyl chloride (PubChem CID 18739174) has the molecular formula C33H22ClF9O5S and a molecular weight of 737.04 g/mol. Its IUPAC name is 4-[1,2,2,3,3,4-hexafluoro-4-[4-[1-(4-methylphenyl)-1-[4-(1,2,2-trifluoroethenoxy)phenyl]ethyl]phenoxy]cyclobutyl]oxybenzenesulfonyl chloride.
| Compound Name | 4-[1,2,2,3,3,4-hexafluoro-4-[4-[1-(4-methylphenyl)-1-[4-(1,2,2-trifluoroethenoxy)phenyl]ethyl]phenoxy]cyclobutyl]oxybenzenesulfonyl chloride |
|---|---|
| PubChem CID | 18739174 |
| Molecular Formula | C33H22ClF9O5S |
| Molecular Weight | 737.04 g/mol |
| Exact Mass | 736.07 |
| IUPAC Name | 4-[1,2,2,3,3,4-hexafluoro-4-[4-[1-(4-methylphenyl)-1-[4-(1,2,2-trifluoroethenoxy)phenyl]ethyl]phenoxy]cyclobutyl]oxybenzenesulfonyl chloride |
| SMILES | Cc1ccc(C(C)(c2ccc(OC(F)=C(F)F)cc2)c2ccc(OC3(F)C(F)(F)C(F)(F)C3(F)Oc3ccc(S(=O)(=O)Cl)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H22ClF9O5S/c1-19-3-5-20(6-4-19)29(2,21-7-11-23(12-8-21)46-28(37)27(35)36)22-9-13-24(14-10-22)47-32(42)30(38,39)31(40,41)33(32,43)48-25-15-17-26(18-16-25)49(34,44)45/h3-18H,1-2H3 |
| InChIKey | ZOPXSSGBGDXXHP-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.04 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|