C26H23F5O4S — CID 23364768
[1-[4-[4-(difluoromethoxy)-3,5-difluorophenyl]-3-fluorophenyl]cyclohexyl]methyl benzenesulfonate (PubChem CID 23364768) has the molecular formula C26H23F5O4S and a molecular weight of 526.52 g/mol. Its IUPAC name is [1-[4-[4-(difluoromethoxy)-3,5-difluorophenyl]-3-fluorophenyl]cyclohexyl]methyl benzenesulfonate.
| Compound Name | [1-[4-[4-(difluoromethoxy)-3,5-difluorophenyl]-3-fluorophenyl]cyclohexyl]methyl benzenesulfonate |
|---|---|
| PubChem CID | 23364768 |
| Molecular Formula | C26H23F5O4S |
| Molecular Weight | 526.52 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | [1-[4-[4-(difluoromethoxy)-3,5-difluorophenyl]-3-fluorophenyl]cyclohexyl]methyl benzenesulfonate |
| SMILES | O=S(=O)(OCC1(c2ccc(-c3cc(F)c(OC(F)F)c(F)c3)c(F)c2)CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C26H23F5O4S/c27-21-15-18(9-10-20(21)17-13-22(28)24(23(29)14-17)35-25(30)31)26(11-5-2-6-12-26)16-34-36(32,33)19-7-3-1-4-8-19/h1,3-4,7-10,13-15,25H,2,5-6,11-12,16H2 |
| InChIKey | XVPWUMMVVONSPD-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.52 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|