C22H26N4O2 — CID 59874572
2-methoxy-6-[4-(4-methoxyphenyl)piperazin-1-yl]-3,7-dimethylquinoxaline (PubChem CID 59874572) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 2-methoxy-6-[4-(4-methoxyphenyl)piperazin-1-yl]-3,7-dimethylquinoxaline.
| Compound Name | 2-methoxy-6-[4-(4-methoxyphenyl)piperazin-1-yl]-3,7-dimethylquinoxaline |
|---|---|
| PubChem CID | 59874572 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 2-methoxy-6-[4-(4-methoxyphenyl)piperazin-1-yl]-3,7-dimethylquinoxaline |
| SMILES | COc1ccc(N2CCN(c3cc4nc(C)c(OC)nc4cc3C)CC2)cc1 |
| InChI | InChI=1S/C22H26N4O2/c1-15-13-19-20(23-16(2)22(24-19)28-4)14-21(15)26-11-9-25(10-12-26)17-5-7-18(27-3)8-6-17/h5-8,13-14H,9-12H2,1-4H3 |
| InChIKey | HJVGAJDMIYYFGA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|