C16H21N3O2 — CID 59874503
4-[(2-methoxy-3,7-dimethylquinoxalin-6-yl)methyl]morpholine (PubChem CID 59874503) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-[(2-methoxy-3,7-dimethylquinoxalin-6-yl)methyl]morpholine.
| Compound Name | 4-[(2-methoxy-3,7-dimethylquinoxalin-6-yl)methyl]morpholine |
|---|---|
| PubChem CID | 59874503 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 4-[(2-methoxy-3,7-dimethylquinoxalin-6-yl)methyl]morpholine |
| SMILES | COc1nc2cc(C)c(CN3CCOCC3)cc2nc1C |
| InChI | InChI=1S/C16H21N3O2/c1-11-8-14-15(17-12(2)16(18-14)20-3)9-13(11)10-19-4-6-21-7-5-19/h8-9H,4-7,10H2,1-3H3 |
| InChIKey | XMSNKABNYWHZSE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |