C14H26O3 — CID 59876117
4,10,15-trioxabicyclo[5.5.5]heptadecane (PubChem CID 59876117) has the molecular formula C14H26O3 and a molecular weight of 242.36 g/mol. Its IUPAC name is 4,10,15-trioxabicyclo[5.5.5]heptadecane.
| Compound Name | 4,10,15-trioxabicyclo[5.5.5]heptadecane |
|---|---|
| PubChem CID | 59876117 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 4,10,15-trioxabicyclo[5.5.5]heptadecane |
| SMILES | C1CC2CCOCCC(CCO1)CCOCC2 |
| InChI | InChI=1S/C14H26O3/c1-7-15-10-4-14-5-11-16-8-2-13(1)3-9-17-12-6-14/h13-14H,1-12H2 |
| InChIKey | DRBVCDPWWBGWEC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |