C32H52N5O6P — CID 59876180
(2S)-2-[[(2S)-2-cyclohexylpropanoyl]amino]-N-[2-hydroxy-1-oxo-1-[[2-oxo-2-[[(1S)-2-oxo-1-phenyl-2-(phosphanylamino)ethyl]amino]ethyl]amino]hexan-3-yl]heptanamide (PubChem CID 59876180) has the molecular formula C32H52N5O6P and a molecular weight of 633.77 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-cyclohexylpropanoyl]amino]-N-[2-hydroxy-1-oxo-1-[[2-oxo-2-[[(1S)-2-oxo-1-phenyl-2-(phosphanylamino)ethyl]amino]ethyl]amino]hexan-3-yl]heptanamide.
| Compound Name | (2S)-2-[[(2S)-2-cyclohexylpropanoyl]amino]-N-[2-hydroxy-1-oxo-1-[[2-oxo-2-[[(1S)-2-oxo-1-phenyl-2-(phosphanylamino)ethyl]amino]ethyl]amino]hexan-3-yl]heptanamide |
|---|---|
| PubChem CID | 59876180 |
| Molecular Formula | C32H52N5O6P |
| Molecular Weight | 633.77 g/mol |
| Exact Mass | 633.37 |
| IUPAC Name | (2S)-2-[[(2S)-2-cyclohexylpropanoyl]amino]-N-[2-hydroxy-1-oxo-1-[[2-oxo-2-[[(1S)-2-oxo-1-phenyl-2-(phosphanylamino)ethyl]amino]ethyl]amino]hexan-3-yl]heptanamide |
| SMILES | CCCCC[C@H](NC(=O)[C@@H](C)C1CCCCC1)C(=O)NC(CCC)C(O)C(=O)NCC(=O)N[C@H](C(=O)NP)c1ccccc1 |
| InChI | InChI=1S/C32H52N5O6P/c1-4-6-9-19-25(35-29(40)21(3)22-15-10-7-11-16-22)30(41)34-24(14-5-2)28(39)32(43)33-20-26(38)36-27(31(42)37-44)23-17-12-8-13-18-23/h8,12-13,17-18,21-22,24-25,27-28,39H,4-7,9-11,14-16,19-20,44H2,1-3H3,(H,33,43)(H,34,41)(H,35,40)(H,36,38)(H,37,42)/t21-,24?,25-,27-,28?/m0/s1 |
| InChIKey | TULLJMCKZKQRJH-ZJSCPOQBSA-N |
| XLogP | 2.79 |
| TPSA | 165.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.77 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|