C8H17NO2Y-2 — CID 59879059
N,N-dimethylpropan-2-amine;ethoxymethanone;yttrium (PubChem CID 59879059) has the molecular formula C8H17NO2Y-2 and a molecular weight of 248.13 g/mol. Its IUPAC name is N,N-dimethylpropan-2-amine;ethoxymethanone;yttrium.
| Compound Name | N,N-dimethylpropan-2-amine;ethoxymethanone;yttrium |
|---|---|
| PubChem CID | 59879059 |
| Molecular Formula | C8H17NO2Y-2 |
| Molecular Weight | 248.13 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | N,N-dimethylpropan-2-amine;ethoxymethanone;yttrium |
| SMILES | CCO[C-]=O.C[C-](C)N(C)C.[Y] |
| InChI | InChI=1S/C5H12N.C3H5O2.Y/c1-5(2)6(3)4;1-2-5-3-4;/h1-4H3;2H2,1H3;/q2*-1; |
| InChIKey | GTBPHPSNAODXBU-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.13 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|