C29H39NO3S — CID 59879226
(13S)-7-[4-[2-(dimethylamino)ethoxy]phenyl]sulfanyl-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 59879226) has the molecular formula C29H39NO3S and a molecular weight of 481.70 g/mol. Its IUPAC name is (13S)-7-[4-[2-(dimethylamino)ethoxy]phenyl]sulfanyl-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (13S)-7-[4-[2-(dimethylamino)ethoxy]phenyl]sulfanyl-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 59879226 |
| Molecular Formula | C29H39NO3S |
| Molecular Weight | 481.70 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | (13S)-7-[4-[2-(dimethylamino)ethoxy]phenyl]sulfanyl-3-methoxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | COc1ccc2c(c1)CC(Sc1ccc(OCCN(C)C)cc1)C1C2CC[C@]2(C)C(O)CCC12 |
| InChI | InChI=1S/C29H39NO3S/c1-29-14-13-24-23-10-7-21(32-4)17-19(23)18-26(28(24)25(29)11-12-27(29)31)34-22-8-5-20(6-9-22)33-16-15-30(2)3/h5-10,17,24-28,31H,11-16,18H2,1-4H3/t24?,25?,26?,27?,28?,29-/m0/s1 |
| InChIKey | STGIGZIKYIEKQF-UPORQSFNSA-N |
| XLogP | 5.62 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.70 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |