C13H27NY-2 — CID 59881198
(3-methanidyl-3-methylbutyl)-(2,3,3-trimethylbutan-2-yl)azanide;yttrium (PubChem CID 59881198) has the molecular formula C13H27NY-2 and a molecular weight of 286.27 g/mol. Its IUPAC name is (3-methanidyl-3-methylbutyl)-(2,3,3-trimethylbutan-2-yl)azanide;yttrium.
| Compound Name | (3-methanidyl-3-methylbutyl)-(2,3,3-trimethylbutan-2-yl)azanide;yttrium |
|---|---|
| PubChem CID | 59881198 |
| Molecular Formula | C13H27NY-2 |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (3-methanidyl-3-methylbutyl)-(2,3,3-trimethylbutan-2-yl)azanide;yttrium |
| SMILES | [CH2-]C(C)(C)CC[N-]C(C)(C)C(C)(C)C.[Y] |
| InChI | InChI=1S/C13H27N.Y/c1-11(2,3)9-10-14-13(7,8)12(4,5)6;/h1,9-10H2,2-8H3;/q-2; |
| InChIKey | JPPOZXOBZPKQIF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|