About tert-butyl(ethyl)azanide;ethane;yttrium
tert-butyl(ethyl)azanide;ethane;yttrium (PubChem CID 158619467) has the molecular formula C8H19NY-2
and a molecular weight of 218.15 g/mol. Its IUPAC name is tert-butyl(ethyl)azanide;ethane;yttrium.
Molecular Properties
| Compound Name | tert-butyl(ethyl)azanide;ethane;yttrium |
| PubChem CID | 158619467 |
| Molecular Formula | C8H19NY-2 |
| Molecular Weight | 218.15 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | tert-butyl(ethyl)azanide;ethane;yttrium |
| SMILES | CC.[CH2-]C[N-]C(C)(C)C.[Y] |
| InChI | InChI=1S/C6H13N.C2H6.Y/c1-5-7-6(2,3)4;1-2;/h1,5H2,2-4H3;1-2H3;/q-2;; |
| InChIKey | CZYUBVMNOSLTJF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.15 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl(ethyl)azanide;ethane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl(ethyl)azanide;ethane;yttrium?
The IUPAC name of tert-butyl(ethyl)azanide;ethane;yttrium (CID 158619467) is tert-butyl(ethyl)azanide;ethane;yttrium.
What is the SMILES notation for tert-butyl(ethyl)azanide;ethane;yttrium?
The canonical SMILES for tert-butyl(ethyl)azanide;ethane;yttrium is CC.[CH2-]C[N-]C(C)(C)C.[Y].
What is the InChIKey of tert-butyl(ethyl)azanide;ethane;yttrium?
The InChIKey is CZYUBVMNOSLTJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N.C2H6.Y/c1-5-7-6(2,3)4;1-2;/h1,5H2,2-4H3;1-2H3;/q-2;;.
What are the key properties of tert-butyl(ethyl)azanide;ethane;yttrium?
tert-butyl(ethyl)azanide;ethane;yttrium has a molecular weight of 218.15 g/mol, XLogP of 3.02, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl(ethyl)azanide;ethane;yttrium is sourced from PubChem (CID 158619467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).