About tert-butyl(2-tert-butylazanidylethyl)azanide;manganese(2+)
tert-butyl(2-tert-butylazanidylethyl)azanide;manganese(2+) (PubChem CID 140844875) has the molecular formula C10H22MnN2
and a molecular weight of 225.24 g/mol. Its IUPAC name is tert-butyl(2-tert-butylazanidylethyl)azanide;manganese(2+).
Molecular Properties
| Compound Name | tert-butyl(2-tert-butylazanidylethyl)azanide;manganese(2+) |
| PubChem CID | 140844875 |
| Molecular Formula | C10H22MnN2 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | tert-butyl(2-tert-butylazanidylethyl)azanide;manganese(2+) |
| SMILES | CC(C)(C)[N-]CC[N-]C(C)(C)C.[Mn+2] |
| InChI | InChI=1S/C10H22N2.Mn/c1-9(2,3)11-7-8-12-10(4,5)6;/h7-8H2,1-6H3;/q-2;+2 |
| InChIKey | PMYWTKAQOKRNKB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl(2-tert-butylazanidylethyl)azanide;manganese(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl(2-tert-butylazanidylethyl)azanide;manganese(2+)?
The IUPAC name of tert-butyl(2-tert-butylazanidylethyl)azanide;manganese(2+) (CID 140844875) is tert-butyl(2-tert-butylazanidylethyl)azanide;manganese(2+).
What is the SMILES notation for tert-butyl(2-tert-butylazanidylethyl)azanide;manganese(2+)?
The canonical SMILES for tert-butyl(2-tert-butylazanidylethyl)azanide;manganese(2+) is CC(C)(C)[N-]CC[N-]C(C)(C)C.[Mn+2].
What is the InChIKey of tert-butyl(2-tert-butylazanidylethyl)azanide;manganese(2+)?
The InChIKey is PMYWTKAQOKRNKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2.Mn/c1-9(2,3)11-7-8-12-10(4,5)6;/h7-8H2,1-6H3;/q-2;+2.
What are the key properties of tert-butyl(2-tert-butylazanidylethyl)azanide;manganese(2+)?
tert-butyl(2-tert-butylazanidylethyl)azanide;manganese(2+) has a molecular weight of 225.24 g/mol, XLogP of 3.33, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl(2-tert-butylazanidylethyl)azanide;manganese(2+) is sourced from PubChem (CID 140844875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).