C9H20KNO2 — CID 145053794
potassium tert-butyl(2,3-dimethoxypropyl)azanide (PubChem CID 145053794) has the molecular formula C9H20KNO2 and a molecular weight of 213.36 g/mol. Its IUPAC name is potassium tert-butyl(2,3-dimethoxypropyl)azanide.
| Compound Name | potassium tert-butyl(2,3-dimethoxypropyl)azanide |
|---|---|
| PubChem CID | 145053794 |
| Molecular Formula | C9H20KNO2 |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | potassium tert-butyl(2,3-dimethoxypropyl)azanide |
| SMILES | COCC(C[N-]C(C)(C)C)OC.[K+] |
| InChI | InChI=1S/C9H20NO2.K/c1-9(2,3)10-6-8(12-5)7-11-4;/h8H,6-7H2,1-5H3;/q-1;+1 |
| InChIKey | HDRJOYXCLPIMFJ-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 32.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |