C23H27NO5 — CID 59881426
(2R,3S,4R,5R,6S)-5-(benzhydrylideneamino)-2-(hydroxymethyl)-4-methoxy-6-[(Z)-prop-1-enoxy]oxan-3-ol (PubChem CID 59881426) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-5-(benzhydrylideneamino)-2-(hydroxymethyl)-4-methoxy-6-[(Z)-prop-1-enoxy]oxan-3-ol.
| Compound Name | (2R,3S,4R,5R,6S)-5-(benzhydrylideneamino)-2-(hydroxymethyl)-4-methoxy-6-[(Z)-prop-1-enoxy]oxan-3-ol |
|---|---|
| PubChem CID | 59881426 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | (2R,3S,4R,5R,6S)-5-(benzhydrylideneamino)-2-(hydroxymethyl)-4-methoxy-6-[(Z)-prop-1-enoxy]oxan-3-ol |
| SMILES | C/C=C\O[C@H]1O[C@H](CO)[C@@H](O)[C@H](OC)[C@H]1N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H27NO5/c1-3-14-28-23-20(22(27-2)21(26)18(15-25)29-23)24-19(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h3-14,18,20-23,25-26H,15H2,1-2H3/b14-3-/t18-,20-,21-,22-,23+/m1/s1 |
| InChIKey | VRGPFIDOLGVLPD-IXPVLOORSA-N |
| XLogP | 2.54 |
| TPSA | 80.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|