C38H59NO5Si — CID 91368683
(2R,3S,4R,5R,6S)-5-(benzhydrylideneamino)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-decoxy-6-prop-1-enoxyoxan-3-ol (PubChem CID 91368683) has the molecular formula C38H59NO5Si and a molecular weight of 637.98 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-5-(benzhydrylideneamino)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-decoxy-6-prop-1-enoxyoxan-3-ol.
| Compound Name | (2R,3S,4R,5R,6S)-5-(benzhydrylideneamino)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-decoxy-6-prop-1-enoxyoxan-3-ol |
|---|---|
| PubChem CID | 91368683 |
| Molecular Formula | C38H59NO5Si |
| Molecular Weight | 637.98 g/mol |
| Exact Mass | 637.42 |
| IUPAC Name | (2R,3S,4R,5R,6S)-5-(benzhydrylideneamino)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-decoxy-6-prop-1-enoxyoxan-3-ol |
| SMILES | CC=CO[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](OCCCCCCCCCC)[C@H]1N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H59NO5Si/c1-8-10-11-12-13-14-15-22-28-41-36-34(39-33(30-23-18-16-19-24-30)31-25-20-17-21-26-31)37(42-27-9-2)44-32(35(36)40)29-43-45(6,7)38(3,4)5/h9,16-21,23-27,32,34-37,40H,8,10-15,22,28-29H2,1-7H3/t32-,34-,35-,36-,37+/m1/s1 |
| InChIKey | BEYBMSIDJUEPDH-OETHFQCBSA-N |
| XLogP | 9.08 |
| TPSA | 69.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.98 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|