About 4-(butan-2-ylsulfanylmethyl)-3,5-dimethyl-1,2-oxazole
4-(butan-2-ylsulfanylmethyl)-3,5-dimethyl-1,2-oxazole (PubChem CID 59882082) has the molecular formula C10H17NOS
and a molecular weight of 199.32 g/mol. Its IUPAC name is 4-(butan-2-ylsulfanylmethyl)-3,5-dimethyl-1,2-oxazole.
Analyze 4-(butan-2-ylsulfanylmethyl)-3,5-dimethyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(butan-2-ylsulfanylmethyl)-3,5-dimethyl-1,2-oxazole?
The IUPAC name of 4-(butan-2-ylsulfanylmethyl)-3,5-dimethyl-1,2-oxazole (CID 59882082) is 4-(butan-2-ylsulfanylmethyl)-3,5-dimethyl-1,2-oxazole.
What is the SMILES notation for 4-(butan-2-ylsulfanylmethyl)-3,5-dimethyl-1,2-oxazole?
The canonical SMILES for 4-(butan-2-ylsulfanylmethyl)-3,5-dimethyl-1,2-oxazole is CCC(C)SCc1c(C)noc1C.
What is the InChIKey of 4-(butan-2-ylsulfanylmethyl)-3,5-dimethyl-1,2-oxazole?
The InChIKey is RFJOAYVDVYKYII-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NOS/c1-5-7(2)13-6-10-8(3)11-12-9(10)4/h7H,5-6H2,1-4H3.
What are the key properties of 4-(butan-2-ylsulfanylmethyl)-3,5-dimethyl-1,2-oxazole?
4-(butan-2-ylsulfanylmethyl)-3,5-dimethyl-1,2-oxazole has a molecular weight of 199.32 g/mol, XLogP of 3.32, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(butan-2-ylsulfanylmethyl)-3,5-dimethyl-1,2-oxazole is sourced from PubChem (CID 59882082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).