C14H16N4O2S3 — CID 35696308
4-[[5-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-3,5-dimethyl-1,2-oxazole (PubChem CID 35696308) has the molecular formula C14H16N4O2S3 and a molecular weight of 368.51 g/mol. Its IUPAC name is 4-[[5-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[[5-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 35696308 |
| Molecular Formula | C14H16N4O2S3 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | 4-[[5-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1CSc1nnc(SCc2c(C)noc2C)s1 |
| InChI | InChI=1S/C14H16N4O2S3/c1-7-11(9(3)19-17-7)5-21-13-15-16-14(23-13)22-6-12-8(2)18-20-10(12)4/h5-6H2,1-4H3 |
| InChIKey | XTVJNWBUSYWKJB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |