C13H24N2O4 — CID 59883420
methyl (E,3S)-3-[[2-(3-methoxypropylamino)acetyl]amino]hex-4-enoate (PubChem CID 59883420) has the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. Its IUPAC name is methyl (E,3S)-3-[[2-(3-methoxypropylamino)acetyl]amino]hex-4-enoate.
| Compound Name | methyl (E,3S)-3-[[2-(3-methoxypropylamino)acetyl]amino]hex-4-enoate |
|---|---|
| PubChem CID | 59883420 |
| Molecular Formula | C13H24N2O4 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | methyl (E,3S)-3-[[2-(3-methoxypropylamino)acetyl]amino]hex-4-enoate |
| SMILES | C/C=C/[C@H](CC(=O)OC)NC(=O)CNCCCOC |
| InChI | InChI=1S/C13H24N2O4/c1-4-6-11(9-13(17)19-3)15-12(16)10-14-7-5-8-18-2/h4,6,11,14H,5,7-10H2,1-3H3,(H,15,16)/b6-4+/t11-/m1/s1 |
| InChIKey | DCQXCLZYWHQYNJ-DUMNWFOQSA-N |
| XLogP | 0.24 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|