C11H14AcN2O2 — CID 59883958
actinium;(5S)-5-[(4-hydroxyphenyl)methyl]-3-methylimidazolidin-4-one (PubChem CID 59883958) has the molecular formula C11H14AcN2O2 and a molecular weight of 433.25 g/mol. Its IUPAC name is actinium;(5S)-5-[(4-hydroxyphenyl)methyl]-3-methylimidazolidin-4-one.
| Compound Name | actinium;(5S)-5-[(4-hydroxyphenyl)methyl]-3-methylimidazolidin-4-one |
|---|---|
| PubChem CID | 59883958 |
| Molecular Formula | C11H14AcN2O2 |
| Molecular Weight | 433.25 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | actinium;(5S)-5-[(4-hydroxyphenyl)methyl]-3-methylimidazolidin-4-one |
| SMILES | CN1CN[C@@H](Cc2ccc(O)cc2)C1=O.[Ac] |
| InChI | InChI=1S/C11H14N2O2.Ac/c1-13-7-12-10(11(13)15)6-8-2-4-9(14)5-3-8;/h2-5,10,12,14H,6-7H2,1H3;/t10-;/m0./s1 |
| InChIKey | STJKHNCCKTWRJF-PPHPATTJSA-N |
| XLogP | 0.32 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.25 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |