C11H12F2N2O — CID 59884194
(5S)-5-[(3,5-difluorophenyl)methyl]-3-methylimidazolidin-4-one (PubChem CID 59884194) has the molecular formula C11H12F2N2O and a molecular weight of 226.23 g/mol. Its IUPAC name is (5S)-5-[(3,5-difluorophenyl)methyl]-3-methylimidazolidin-4-one.
| Compound Name | (5S)-5-[(3,5-difluorophenyl)methyl]-3-methylimidazolidin-4-one |
|---|---|
| PubChem CID | 59884194 |
| Molecular Formula | C11H12F2N2O |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | (5S)-5-[(3,5-difluorophenyl)methyl]-3-methylimidazolidin-4-one |
| SMILES | CN1CN[C@@H](Cc2cc(F)cc(F)c2)C1=O |
| InChI | InChI=1S/C11H12F2N2O/c1-15-6-14-10(11(15)16)4-7-2-8(12)5-9(13)3-7/h2-3,5,10,14H,4,6H2,1H3/t10-/m0/s1 |
| InChIKey | BIHUKBYSSUPHJR-JTQLQIEISA-N |
| XLogP | 0.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |