About N-propylbutan-2-amine;yttrium
N-propylbutan-2-amine;yttrium (PubChem CID 59885573) has the molecular formula C7H15NY-2
and a molecular weight of 202.11 g/mol. Its IUPAC name is N-propylbutan-2-amine;yttrium.
Molecular Properties
| Compound Name | N-propylbutan-2-amine;yttrium |
| PubChem CID | 59885573 |
| Molecular Formula | C7H15NY-2 |
| Molecular Weight | 202.11 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | N-propylbutan-2-amine;yttrium |
| SMILES | [CH2-]C(CC)NC[CH-]C.[Y] |
| InChI | InChI=1S/C7H15N.Y/c1-4-6-8-7(3)5-2;/h4,7-8H,3,5-6H2,1-2H3;/q-2; |
| InChIKey | YSYDBEQPCYGLOJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.11 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N-propylbutan-2-amine;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propylbutan-2-amine;yttrium?
The IUPAC name of N-propylbutan-2-amine;yttrium (CID 59885573) is N-propylbutan-2-amine;yttrium.
What is the SMILES notation for N-propylbutan-2-amine;yttrium?
The canonical SMILES for N-propylbutan-2-amine;yttrium is [CH2-]C(CC)NC[CH-]C.[Y].
What is the InChIKey of N-propylbutan-2-amine;yttrium?
The InChIKey is YSYDBEQPCYGLOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N.Y/c1-4-6-8-7(3)5-2;/h4,7-8H,3,5-6H2,1-2H3;/q-2;.
What are the key properties of N-propylbutan-2-amine;yttrium?
N-propylbutan-2-amine;yttrium has a molecular weight of 202.11 g/mol, XLogP of 1.41, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-propylbutan-2-amine;yttrium is sourced from PubChem (CID 59885573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).