About butan-2-ol;yttrium
butan-2-ol;yttrium (PubChem CID 59946185) has the molecular formula C4H9OY-
and a molecular weight of 162.02 g/mol. Its IUPAC name is butan-2-ol;yttrium.
Molecular Properties
| Compound Name | butan-2-ol;yttrium |
| PubChem CID | 59946185 |
| Molecular Formula | C4H9OY- |
| Molecular Weight | 162.02 g/mol |
| Exact Mass | 161.97 |
| IUPAC Name | butan-2-ol;yttrium |
| SMILES | [CH2-]C(O)CC.[Y] |
| InChI | InChI=1S/C4H9O.Y/c1-3-4(2)5;/h4-5H,2-3H2,1H3;/q-1; |
| InChIKey | XBUDVWXNKCBPAR-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.02 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze butan-2-ol;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-ol;yttrium?
The IUPAC name of butan-2-ol;yttrium (CID 59946185) is butan-2-ol;yttrium.
What is the SMILES notation for butan-2-ol;yttrium?
The canonical SMILES for butan-2-ol;yttrium is [CH2-]C(O)CC.[Y].
What is the InChIKey of butan-2-ol;yttrium?
The InChIKey is XBUDVWXNKCBPAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9O.Y/c1-3-4(2)5;/h4-5H,2-3H2,1H3;/q-1;.
What are the key properties of butan-2-ol;yttrium?
butan-2-ol;yttrium has a molecular weight of 162.02 g/mol, XLogP of 0.59, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-ol;yttrium is sourced from PubChem (CID 59946185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).