About butan-2-ol
butan-2-ol (PubChem CID 123926829) has the molecular formula C4H9O-
and a molecular weight of 73.12 g/mol. Its IUPAC name is butan-2-ol.
Molecular Properties
| Compound Name | butan-2-ol |
| PubChem CID | 123926829 |
| Molecular Formula | C4H9O- |
| Molecular Weight | 73.12 g/mol |
| Exact Mass | 73.07 |
| IUPAC Name | butan-2-ol |
| SMILES | [CH2-]C(O)CC |
| InChI | InChI=1S/C4H9O/c1-3-4(2)5/h4-5H,2-3H2,1H3/q-1 |
| InChIKey | BKLDLUFZXHBNSS-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 73.12 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-ol?
The IUPAC name of butan-2-ol (CID 123926829) is butan-2-ol.
What is the SMILES notation for butan-2-ol?
The canonical SMILES for butan-2-ol is [CH2-]C(O)CC.
What is the InChIKey of butan-2-ol?
The InChIKey is BKLDLUFZXHBNSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9O/c1-3-4(2)5/h4-5H,2-3H2,1H3/q-1.
What are the key properties of butan-2-ol?
butan-2-ol has a molecular weight of 73.12 g/mol, XLogP of 0.59, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-ol is sourced from PubChem (CID 123926829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).