About sodium 3-methanidylpentane
sodium 3-methanidylpentane (PubChem CID 154114323) has the molecular formula C6H13Na
and a molecular weight of 108.16 g/mol. Its IUPAC name is sodium 3-methanidylpentane.
Molecular Properties
| Compound Name | sodium 3-methanidylpentane |
| PubChem CID | 154114323 |
| Molecular Formula | C6H13Na |
| Molecular Weight | 108.16 g/mol |
| Exact Mass | 108.09 |
| IUPAC Name | sodium 3-methanidylpentane |
| SMILES | [CH2-]C(CC)CC.[Na+] |
| InChI | InChI=1S/C6H13.Na/c1-4-6(3)5-2;/h6H,3-5H2,1-2H3;/q-1;+1 |
| InChIKey | BIDNKKGMPLKPTD-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.16 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze sodium 3-methanidylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3-methanidylpentane?
The IUPAC name of sodium 3-methanidylpentane (CID 154114323) is sodium 3-methanidylpentane.
What is the SMILES notation for sodium 3-methanidylpentane?
The canonical SMILES for sodium 3-methanidylpentane is [CH2-]C(CC)CC.[Na+].
What is the InChIKey of sodium 3-methanidylpentane?
The InChIKey is BIDNKKGMPLKPTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13.Na/c1-4-6(3)5-2;/h6H,3-5H2,1-2H3;/q-1;+1.
What are the key properties of sodium 3-methanidylpentane?
sodium 3-methanidylpentane has a molecular weight of 108.16 g/mol, XLogP of -0.74, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-methanidylpentane is sourced from PubChem (CID 154114323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).