About sodium;2-methanidylpropane;hydroxide
sodium;2-methanidylpropane;hydroxide (PubChem CID 58205934) has the molecular formula C4H10NaO-
and a molecular weight of 97.11 g/mol. Its IUPAC name is sodium;2-methanidylpropane;hydroxide.
Molecular Properties
| Compound Name | sodium;2-methanidylpropane;hydroxide |
| PubChem CID | 58205934 |
| Molecular Formula | C4H10NaO- |
| Molecular Weight | 97.11 g/mol |
| Exact Mass | 97.06 |
| IUPAC Name | sodium;2-methanidylpropane;hydroxide |
| SMILES | [CH2-]C(C)C.[Na+].[OH-] |
| InChI | InChI=1S/C4H9.Na.H2O/c1-4(2)3;;/h4H,1H2,2-3H3;;1H2/q-1;+1;/p-1 |
| InChIKey | LTELNZLGNGWNSK-UHFFFAOYSA-M |
| XLogP | -1.70 |
| TPSA | 30.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.11 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-methanidylpropane;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-methanidylpropane;hydroxide?
The IUPAC name of sodium;2-methanidylpropane;hydroxide (CID 58205934) is sodium;2-methanidylpropane;hydroxide.
What is the SMILES notation for sodium;2-methanidylpropane;hydroxide?
The canonical SMILES for sodium;2-methanidylpropane;hydroxide is [CH2-]C(C)C.[Na+].[OH-].
What is the InChIKey of sodium;2-methanidylpropane;hydroxide?
The InChIKey is LTELNZLGNGWNSK-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H9.Na.H2O/c1-4(2)3;;/h4H,1H2,2-3H3;;1H2/q-1;+1;/p-1.
What are the key properties of sodium;2-methanidylpropane;hydroxide?
sodium;2-methanidylpropane;hydroxide has a molecular weight of 97.11 g/mol, XLogP of -1.70, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-methanidylpropane;hydroxide is sourced from PubChem (CID 58205934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).