About 2-methanidylpropane;decakis(yttrium)
2-methanidylpropane;decakis(yttrium) (PubChem CID 167360236) has the molecular formula C4H9Y10-
and a molecular weight of 946.18 g/mol. Its IUPAC name is 2-methanidylpropane;decakis(yttrium).
Molecular Properties
| Compound Name | 2-methanidylpropane;decakis(yttrium) |
| PubChem CID | 167360236 |
| Molecular Formula | C4H9Y10- |
| Molecular Weight | 946.18 g/mol |
| Exact Mass | 946.13 |
| IUPAC Name | 2-methanidylpropane;decakis(yttrium) |
| SMILES | [CH2-]C(C)C.[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y] |
| InChI | InChI=1S/C4H9.10Y/c1-4(2)3;;;;;;;;;;/h4H,1H2,2-3H3;;;;;;;;;;/q-1;;;;;;;;;; |
| InChIKey | FUYIEDGAECOIJR-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 946.18 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-methanidylpropane;decakis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methanidylpropane;decakis(yttrium)?
The IUPAC name of 2-methanidylpropane;decakis(yttrium) (CID 167360236) is 2-methanidylpropane;decakis(yttrium).
What is the SMILES notation for 2-methanidylpropane;decakis(yttrium)?
The canonical SMILES for 2-methanidylpropane;decakis(yttrium) is [CH2-]C(C)C.[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].[Y].
What is the InChIKey of 2-methanidylpropane;decakis(yttrium)?
The InChIKey is FUYIEDGAECOIJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9.10Y/c1-4(2)3;;;;;;;;;;/h4H,1H2,2-3H3;;;;;;;;;;/q-1;;;;;;;;;;.
What are the key properties of 2-methanidylpropane;decakis(yttrium)?
2-methanidylpropane;decakis(yttrium) has a molecular weight of 946.18 g/mol, XLogP of 1.45, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methanidylpropane;decakis(yttrium) is sourced from PubChem (CID 167360236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).