About carbanide;2-methanidylpropane;bis(yttrium)
carbanide;2-methanidylpropane;bis(yttrium) (PubChem CID 161365817) has the molecular formula C5H12Y2-2
and a molecular weight of 249.96 g/mol. Its IUPAC name is carbanide;2-methanidylpropane;bis(yttrium).
Molecular Properties
| Compound Name | carbanide;2-methanidylpropane;bis(yttrium) |
| PubChem CID | 161365817 |
| Molecular Formula | C5H12Y2-2 |
| Molecular Weight | 249.96 g/mol |
| Exact Mass | 249.91 |
| IUPAC Name | carbanide;2-methanidylpropane;bis(yttrium) |
| SMILES | [CH2-]C(C)C.[CH3-].[Y].[Y] |
| InChI | InChI=1S/C4H9.CH3.2Y/c1-4(2)3;;;/h4H,1H2,2-3H3;1H3;;/q2*-1;; |
| InChIKey | GILSNAXLWSEOQB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.96 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;2-methanidylpropane;bis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;2-methanidylpropane;bis(yttrium)?
The IUPAC name of carbanide;2-methanidylpropane;bis(yttrium) (CID 161365817) is carbanide;2-methanidylpropane;bis(yttrium).
What is the SMILES notation for carbanide;2-methanidylpropane;bis(yttrium)?
The canonical SMILES for carbanide;2-methanidylpropane;bis(yttrium) is [CH2-]C(C)C.[CH3-].[Y].[Y].
What is the InChIKey of carbanide;2-methanidylpropane;bis(yttrium)?
The InChIKey is GILSNAXLWSEOQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9.CH3.2Y/c1-4(2)3;;;/h4H,1H2,2-3H3;1H3;;/q2*-1;;.
What are the key properties of carbanide;2-methanidylpropane;bis(yttrium)?
carbanide;2-methanidylpropane;bis(yttrium) has a molecular weight of 249.96 g/mol, XLogP of 1.92, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;2-methanidylpropane;bis(yttrium) is sourced from PubChem (CID 161365817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).