About ethane;2-methanidylpropane;tungsten(2+)
ethane;2-methanidylpropane;tungsten(2+) (PubChem CID 20607309) has the molecular formula C6H14W
and a molecular weight of 270.02 g/mol. Its IUPAC name is ethane;2-methanidylpropane;tungsten(2+).
Molecular Properties
| Compound Name | ethane;2-methanidylpropane;tungsten(2+) |
| PubChem CID | 20607309 |
| Molecular Formula | C6H14W |
| Molecular Weight | 270.02 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | ethane;2-methanidylpropane;tungsten(2+) |
| SMILES | [CH2-]C.[CH2-]C(C)C.[W+2] |
| InChI | InChI=1S/C4H9.C2H5.W/c1-4(2)3;1-2;/h4H,1H2,2-3H3;1H2,2H3;/q2*-1;+2 |
| InChIKey | DYJKUNQFTXFVRR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.02 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methanidylpropane;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methanidylpropane;tungsten(2+)?
The IUPAC name of ethane;2-methanidylpropane;tungsten(2+) (CID 20607309) is ethane;2-methanidylpropane;tungsten(2+).
What is the SMILES notation for ethane;2-methanidylpropane;tungsten(2+)?
The canonical SMILES for ethane;2-methanidylpropane;tungsten(2+) is [CH2-]C.[CH2-]C(C)C.[W+2].
What is the InChIKey of ethane;2-methanidylpropane;tungsten(2+)?
The InChIKey is DYJKUNQFTXFVRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9.C2H5.W/c1-4(2)3;1-2;/h4H,1H2,2-3H3;1H2,2H3;/q2*-1;+2.
What are the key properties of ethane;2-methanidylpropane;tungsten(2+)?
ethane;2-methanidylpropane;tungsten(2+) has a molecular weight of 270.02 g/mol, XLogP of 2.31, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methanidylpropane;tungsten(2+) is sourced from PubChem (CID 20607309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).