About propan-2-ol;yttrium
propan-2-ol;yttrium (PubChem CID 59895295) has the molecular formula C3H7OY-
and a molecular weight of 147.99 g/mol. Its IUPAC name is propan-2-ol;yttrium.
Molecular Properties
| Compound Name | propan-2-ol;yttrium |
| PubChem CID | 59895295 |
| Molecular Formula | C3H7OY- |
| Molecular Weight | 147.99 g/mol |
| Exact Mass | 147.96 |
| IUPAC Name | propan-2-ol;yttrium |
| SMILES | [CH2-]C(C)O.[Y] |
| InChI | InChI=1S/C3H7O.Y/c1-3(2)4;/h3-4H,1H2,2H3;/q-1; |
| InChIKey | QORUDEKGCISJOI-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.99 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze propan-2-ol;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-ol;yttrium?
The IUPAC name of propan-2-ol;yttrium (CID 59895295) is propan-2-ol;yttrium.
What is the SMILES notation for propan-2-ol;yttrium?
The canonical SMILES for propan-2-ol;yttrium is [CH2-]C(C)O.[Y].
What is the InChIKey of propan-2-ol;yttrium?
The InChIKey is QORUDEKGCISJOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7O.Y/c1-3(2)4;/h3-4H,1H2,2H3;/q-1;.
What are the key properties of propan-2-ol;yttrium?
propan-2-ol;yttrium has a molecular weight of 147.99 g/mol, XLogP of 0.20, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-ol;yttrium is sourced from PubChem (CID 59895295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).