About propan-2-ol;titanium(4+);tetrachloride
propan-2-ol;titanium(4+);tetrachloride (PubChem CID 157071877) has the molecular formula C3H8Cl4OTi
and a molecular weight of 249.78 g/mol. Its IUPAC name is propan-2-ol;titanium(4+);tetrachloride.
Molecular Properties
| Compound Name | propan-2-ol;titanium(4+);tetrachloride |
| PubChem CID | 157071877 |
| Molecular Formula | C3H8Cl4OTi |
| Molecular Weight | 249.78 g/mol |
| Exact Mass | 247.88 |
| IUPAC Name | propan-2-ol;titanium(4+);tetrachloride |
| SMILES | CC(C)O.[Cl-].[Cl-].[Cl-].[Cl-].[Ti+4] |
| InChI | InChI=1S/C3H8O.4ClH.Ti/c1-3(2)4;;;;;/h3-4H,1-2H3;4*1H;/q;;;;;+4/p-4 |
| InChIKey | ACNICLZFNJWNBW-UHFFFAOYSA-J |
| XLogP | -11.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.78 |
| LogP ≤ 5 | -11.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze propan-2-ol;titanium(4+);tetrachloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-ol;titanium(4+);tetrachloride?
The IUPAC name of propan-2-ol;titanium(4+);tetrachloride (CID 157071877) is propan-2-ol;titanium(4+);tetrachloride.
What is the SMILES notation for propan-2-ol;titanium(4+);tetrachloride?
The canonical SMILES for propan-2-ol;titanium(4+);tetrachloride is CC(C)O.[Cl-].[Cl-].[Cl-].[Cl-].[Ti+4].
What is the InChIKey of propan-2-ol;titanium(4+);tetrachloride?
The InChIKey is ACNICLZFNJWNBW-UHFFFAOYSA-J. The full InChI is InChI=1S/C3H8O.4ClH.Ti/c1-3(2)4;;;;;/h3-4H,1-2H3;4*1H;/q;;;;;+4/p-4.
What are the key properties of propan-2-ol;titanium(4+);tetrachloride?
propan-2-ol;titanium(4+);tetrachloride has a molecular weight of 249.78 g/mol, XLogP of -11.60, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-ol;titanium(4+);tetrachloride is sourced from PubChem (CID 157071877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).