About neodymium(3+);propan-2-ol;trichloride
neodymium(3+);propan-2-ol;trichloride (PubChem CID 172788287) has the molecular formula C3H8Cl3NdO
and a molecular weight of 310.70 g/mol. Its IUPAC name is neodymium(3+);propan-2-ol;trichloride.
Molecular Properties
| Compound Name | neodymium(3+);propan-2-ol;trichloride |
| PubChem CID | 172788287 |
| Molecular Formula | C3H8Cl3NdO |
| Molecular Weight | 310.70 g/mol |
| Exact Mass | 306.87 |
| IUPAC Name | neodymium(3+);propan-2-ol;trichloride |
| SMILES | CC(C)O.[Cl-].[Cl-].[Cl-].[Nd+3] |
| InChI | InChI=1S/C3H8O.3ClH.Nd/c1-3(2)4;;;;/h3-4H,1-2H3;3*1H;/q;;;;+3/p-3 |
| InChIKey | PFAIXSKVEMXHEN-UHFFFAOYSA-K |
| XLogP | -8.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.70 |
| LogP ≤ 5 | -8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze neodymium(3+);propan-2-ol;trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of neodymium(3+);propan-2-ol;trichloride?
The IUPAC name of neodymium(3+);propan-2-ol;trichloride (CID 172788287) is neodymium(3+);propan-2-ol;trichloride.
What is the SMILES notation for neodymium(3+);propan-2-ol;trichloride?
The canonical SMILES for neodymium(3+);propan-2-ol;trichloride is CC(C)O.[Cl-].[Cl-].[Cl-].[Nd+3].
What is the InChIKey of neodymium(3+);propan-2-ol;trichloride?
The InChIKey is PFAIXSKVEMXHEN-UHFFFAOYSA-K. The full InChI is InChI=1S/C3H8O.3ClH.Nd/c1-3(2)4;;;;/h3-4H,1-2H3;3*1H;/q;;;;+3/p-3.
What are the key properties of neodymium(3+);propan-2-ol;trichloride?
neodymium(3+);propan-2-ol;trichloride has a molecular weight of 310.70 g/mol, XLogP of -8.60, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for neodymium(3+);propan-2-ol;trichloride is sourced from PubChem (CID 172788287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).