About 2-methanidylpropane;tris(propan-2-ol);titanium
2-methanidylpropane;tris(propan-2-ol);titanium (PubChem CID 134890995) has the molecular formula C13H33O3Ti-
and a molecular weight of 285.27 g/mol. Its IUPAC name is 2-methanidylpropane;tris(propan-2-ol);titanium.
Molecular Properties
| Compound Name | 2-methanidylpropane;tris(propan-2-ol);titanium |
| PubChem CID | 134890995 |
| Molecular Formula | C13H33O3Ti- |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 2-methanidylpropane;tris(propan-2-ol);titanium |
| SMILES | CC(C)O.CC(C)O.CC(C)O.[CH2-]C(C)C.[Ti] |
| InChI | InChI=1S/C4H9.3C3H8O.Ti/c1-4(2)3;3*1-3(2)4;/h4H,1H2,2-3H3;3*3-4H,1-2H3;/q-1;;;; |
| InChIKey | IEXJTHSKDRZZTM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-methanidylpropane;tris(propan-2-ol);titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methanidylpropane;tris(propan-2-ol);titanium?
The IUPAC name of 2-methanidylpropane;tris(propan-2-ol);titanium (CID 134890995) is 2-methanidylpropane;tris(propan-2-ol);titanium.
What is the SMILES notation for 2-methanidylpropane;tris(propan-2-ol);titanium?
The canonical SMILES for 2-methanidylpropane;tris(propan-2-ol);titanium is CC(C)O.CC(C)O.CC(C)O.[CH2-]C(C)C.[Ti].
What is the InChIKey of 2-methanidylpropane;tris(propan-2-ol);titanium?
The InChIKey is IEXJTHSKDRZZTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9.3C3H8O.Ti/c1-4(2)3;3*1-3(2)4;/h4H,1H2,2-3H3;3*3-4H,1-2H3;/q-1;;;;.
What are the key properties of 2-methanidylpropane;tris(propan-2-ol);titanium?
2-methanidylpropane;tris(propan-2-ol);titanium has a molecular weight of 285.27 g/mol, XLogP of 2.64, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methanidylpropane;tris(propan-2-ol);titanium is sourced from PubChem (CID 134890995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).