C25H42N3+ — CID 59887619
dimethyl-[3,4,6,7-tetramethyl-2,8-bis(1-methylpyrrolidin-2-ylidene)nona-3,6-dien-5-ylidene]azanium (PubChem CID 59887619) has the molecular formula C25H42N3+ and a molecular weight of 384.63 g/mol. Its IUPAC name is dimethyl-[3,4,6,7-tetramethyl-2,8-bis(1-methylpyrrolidin-2-ylidene)nona-3,6-dien-5-ylidene]azanium.
| Compound Name | dimethyl-[3,4,6,7-tetramethyl-2,8-bis(1-methylpyrrolidin-2-ylidene)nona-3,6-dien-5-ylidene]azanium |
|---|---|
| PubChem CID | 59887619 |
| Molecular Formula | C25H42N3+ |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.34 |
| IUPAC Name | dimethyl-[3,4,6,7-tetramethyl-2,8-bis(1-methylpyrrolidin-2-ylidene)nona-3,6-dien-5-ylidene]azanium |
| SMILES | CC(=C(C)C(C(C)=C(C)C(C)=C1CCCN1C)=[N+](C)C)C(C)=C1CCCN1C |
| InChI | InChI=1S/C25H42N3/c1-17(19(3)23-13-11-15-27(23)9)21(5)25(26(7)8)22(6)18(2)20(4)24-14-12-16-28(24)10/h11-16H2,1-10H3/q+1 |
| InChIKey | HHWPYTXJVBRQBU-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|