C18H39N2Zr-5 — CID 59887640
carbanide;methyl-[1-[3-(2,3,4,5-tetramethylcyclopentyl)propylazanidyl]ethyl]azanide;zirconium (PubChem CID 59887640) has the molecular formula C18H39N2Zr-5 and a molecular weight of 374.75 g/mol. Its IUPAC name is carbanide;methyl-[1-[3-(2,3,4,5-tetramethylcyclopentyl)propylazanidyl]ethyl]azanide;zirconium.
| Compound Name | carbanide;methyl-[1-[3-(2,3,4,5-tetramethylcyclopentyl)propylazanidyl]ethyl]azanide;zirconium |
|---|---|
| PubChem CID | 59887640 |
| Molecular Formula | C18H39N2Zr-5 |
| Molecular Weight | 374.75 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | carbanide;methyl-[1-[3-(2,3,4,5-tetramethylcyclopentyl)propylazanidyl]ethyl]azanide;zirconium |
| SMILES | C[N-]C(C)[N-]CCCC1C(C)C(C)C(C)C1C.[CH3-].[CH3-].[CH3-].[Zr] |
| InChI | InChI=1S/C15H30N2.3CH3.Zr/c1-10-11(2)13(4)15(12(10)3)8-7-9-17-14(5)16-6;;;;/h10-15H,7-9H2,1-6H3;3*1H3;/q-2;3*-1; |
| InChIKey | UPBPHKSXUPMXGS-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.75 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|