C15H28Mg — CID 59888204
magnesium;carbanide;1-(cyclohexylmethyl)-4-methylcyclohexane (PubChem CID 59888204) has the molecular formula C15H28Mg and a molecular weight of 232.69 g/mol. Its IUPAC name is magnesium;carbanide;1-(cyclohexylmethyl)-4-methylcyclohexane.
| Compound Name | magnesium;carbanide;1-(cyclohexylmethyl)-4-methylcyclohexane |
|---|---|
| PubChem CID | 59888204 |
| Molecular Formula | C15H28Mg |
| Molecular Weight | 232.69 g/mol |
| Exact Mass | 232.20 |
| IUPAC Name | magnesium;carbanide;1-(cyclohexylmethyl)-4-methylcyclohexane |
| SMILES | CC1CCC(CC2CC[CH-]CC2)CC1.[CH3-].[Mg+2] |
| InChI | InChI=1S/C14H25.CH3.Mg/c1-12-7-9-14(10-8-12)11-13-5-3-2-4-6-13;;/h2,12-14H,3-11H2,1H3;1H3;/q2*-1;+2 |
| InChIKey | ZXNFFZVSGZLTEV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.69 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|