C19H19IO — CID 59890901
(2E)-2-[(2-ethylphenyl)methylidene]-10-iododeca-3,9-diynal (PubChem CID 59890901) has the molecular formula C19H19IO and a molecular weight of 390.26 g/mol. Its IUPAC name is (2E)-2-[(2-ethylphenyl)methylidene]-10-iododeca-3,9-diynal.
| Compound Name | (2E)-2-[(2-ethylphenyl)methylidene]-10-iododeca-3,9-diynal |
|---|---|
| PubChem CID | 59890901 |
| Molecular Formula | C19H19IO |
| Molecular Weight | 390.26 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | (2E)-2-[(2-ethylphenyl)methylidene]-10-iododeca-3,9-diynal |
| SMILES | CCc1ccccc1/C=C(\C#CCCCCC#CI)C=O |
| InChI | InChI=1S/C19H19IO/c1-2-18-12-8-9-13-19(18)15-17(16-21)11-7-5-3-4-6-10-14-20/h8-9,12-13,15-16H,2-6H2,1H3/b17-15+ |
| InChIKey | OHTWWUJZCFLGMF-BMRADRMJSA-N |
| XLogP | 4.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.26 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|