About (2Z)-10-iodo-2-[(4-methylphenyl)methylidene]deca-3,9-diynal
(2Z)-10-iodo-2-[(4-methylphenyl)methylidene]deca-3,9-diynal (PubChem CID 21336943) has the molecular formula C18H17IO
and a molecular weight of 376.24 g/mol. Its IUPAC name is (2Z)-10-iodo-2-[(4-methylphenyl)methylidene]deca-3,9-diynal.
Molecular Properties
| Compound Name | (2Z)-10-iodo-2-[(4-methylphenyl)methylidene]deca-3,9-diynal |
| PubChem CID | 21336943 |
| Molecular Formula | C18H17IO |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | (2Z)-10-iodo-2-[(4-methylphenyl)methylidene]deca-3,9-diynal |
| SMILES | Cc1ccc(/C=C(/C#CCCCCC#CI)C=O)cc1 |
| InChI | InChI=1S/C18H17IO/c1-16-9-11-17(12-10-16)14-18(15-20)8-6-4-2-3-5-7-13-19/h9-12,14-15H,2-5H2,1H3/b18-14- |
| InChIKey | ZRINKMXYLCJWFQ-JXAWBTAJSA-N |
| XLogP | 4.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-10-iodo-2-[(4-methylphenyl)methylidene]deca-3,9-diynal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-10-iodo-2-[(4-methylphenyl)methylidene]deca-3,9-diynal?
The IUPAC name of (2Z)-10-iodo-2-[(4-methylphenyl)methylidene]deca-3,9-diynal (CID 21336943) is (2Z)-10-iodo-2-[(4-methylphenyl)methylidene]deca-3,9-diynal.
What is the SMILES notation for (2Z)-10-iodo-2-[(4-methylphenyl)methylidene]deca-3,9-diynal?
The canonical SMILES for (2Z)-10-iodo-2-[(4-methylphenyl)methylidene]deca-3,9-diynal is Cc1ccc(/C=C(/C#CCCCCC#CI)C=O)cc1.
What is the InChIKey of (2Z)-10-iodo-2-[(4-methylphenyl)methylidene]deca-3,9-diynal?
The InChIKey is ZRINKMXYLCJWFQ-JXAWBTAJSA-N. The full InChI is InChI=1S/C18H17IO/c1-16-9-11-17(12-10-16)14-18(15-20)8-6-4-2-3-5-7-13-19/h9-12,14-15H,2-5H2,1H3/b18-14-.
What are the key properties of (2Z)-10-iodo-2-[(4-methylphenyl)methylidene]deca-3,9-diynal?
(2Z)-10-iodo-2-[(4-methylphenyl)methylidene]deca-3,9-diynal has a molecular weight of 376.24 g/mol, XLogP of 4.54, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-10-iodo-2-[(4-methylphenyl)methylidene]deca-3,9-diynal is sourced from PubChem (CID 21336943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).