C18H17IO — CID 59890892
(2E)-10-iodo-2-[(4-methylphenyl)methylidene]deca-3,9-diynal (PubChem CID 59890892) has the molecular formula C18H17IO and a molecular weight of 376.24 g/mol. Its IUPAC name is (2E)-10-iodo-2-[(4-methylphenyl)methylidene]deca-3,9-diynal.
| Compound Name | (2E)-10-iodo-2-[(4-methylphenyl)methylidene]deca-3,9-diynal |
|---|---|
| PubChem CID | 59890892 |
| Molecular Formula | C18H17IO |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | (2E)-10-iodo-2-[(4-methylphenyl)methylidene]deca-3,9-diynal |
| SMILES | Cc1ccc(/C=C(\C#CCCCCC#CI)C=O)cc1 |
| InChI | InChI=1S/C18H17IO/c1-16-9-11-17(12-10-16)14-18(15-20)8-6-4-2-3-5-7-13-19/h9-12,14-15H,2-5H2,1H3/b18-14+ |
| InChIKey | ZRINKMXYLCJWFQ-NBVRZTHBSA-N |
| XLogP | 4.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|