C16H18N4O4 — CID 59892675
1-[(4R)-6-ethyl-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,2,4-triazole-3-carboxamide (PubChem CID 59892675) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is 1-[(4R)-6-ethyl-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-[(4R)-6-ethyl-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 59892675 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 1-[(4R)-6-ethyl-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-1,2,4-triazole-3-carboxamide |
| SMILES | CCC1O[C@@H](n2cnc(C(N)=O)n2)C2OC(c3ccccc3)OC12 |
| InChI | InChI=1S/C16H18N4O4/c1-2-10-11-12(24-16(23-11)9-6-4-3-5-7-9)15(22-10)20-8-18-14(19-20)13(17)21/h3-8,10-12,15-16H,2H2,1H3,(H2,17,21)/t10?,11?,12?,15-,16?/m1/s1 |
| InChIKey | ICYMDHOUTSJOJK-ABQMOFGXSA-N |
| XLogP | 1.17 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |