About 2-hydroxynon-8-ene-4,5-dione;rutherfordium
2-hydroxynon-8-ene-4,5-dione;rutherfordium (PubChem CID 59897270) has the molecular formula C9H13O3Rf-
and a molecular weight of 436.20 g/mol. Its IUPAC name is 2-hydroxynon-8-ene-4,5-dione;rutherfordium.
Molecular Properties
| Compound Name | 2-hydroxynon-8-ene-4,5-dione;rutherfordium |
| PubChem CID | 59897270 |
| Molecular Formula | C9H13O3Rf- |
| Molecular Weight | 436.20 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 2-hydroxynon-8-ene-4,5-dione;rutherfordium |
| SMILES | C=CCCC(=O)C(=O)CC([CH2-])O.[Rf] |
| InChI | InChI=1S/C9H13O3.Rf/c1-3-4-5-8(11)9(12)6-7(2)10;/h3,7,10H,1-2,4-6H2;/q-1; |
| InChIKey | HPHOTBMIFRXXAC-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.20 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxynon-8-ene-4,5-dione;rutherfordium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxynon-8-ene-4,5-dione;rutherfordium?
The IUPAC name of 2-hydroxynon-8-ene-4,5-dione;rutherfordium (CID 59897270) is 2-hydroxynon-8-ene-4,5-dione;rutherfordium.
What is the SMILES notation for 2-hydroxynon-8-ene-4,5-dione;rutherfordium?
The canonical SMILES for 2-hydroxynon-8-ene-4,5-dione;rutherfordium is C=CCCC(=O)C(=O)CC([CH2-])O.[Rf].
What is the InChIKey of 2-hydroxynon-8-ene-4,5-dione;rutherfordium?
The InChIKey is HPHOTBMIFRXXAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13O3.Rf/c1-3-4-5-8(11)9(12)6-7(2)10;/h3,7,10H,1-2,4-6H2;/q-1;.
What are the key properties of 2-hydroxynon-8-ene-4,5-dione;rutherfordium?
2-hydroxynon-8-ene-4,5-dione;rutherfordium has a molecular weight of 436.20 g/mol, XLogP of 0.68, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxynon-8-ene-4,5-dione;rutherfordium is sourced from PubChem (CID 59897270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).