C23H24N2O2 — CID 59897683
methyl 6,7-dimethyl-1,7-diazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),5,9,14,16,18-heptaene-5-carboxylate (PubChem CID 59897683) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is methyl 6,7-dimethyl-1,7-diazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),5,9,14,16,18-heptaene-5-carboxylate.
| Compound Name | methyl 6,7-dimethyl-1,7-diazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),5,9,14,16,18-heptaene-5-carboxylate |
|---|---|
| PubChem CID | 59897683 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | methyl 6,7-dimethyl-1,7-diazapentacyclo[11.8.0.03,11.04,8.014,19]henicosa-3(11),4(8),5,9,14,16,18-heptaene-5-carboxylate |
| SMILES | COC(=O)c1c(C)n(C)c2ccc3c(c12)CN1CCc2ccccc2C1C3 |
| InChI | InChI=1S/C23H24N2O2/c1-14-21(23(26)27-3)22-18-13-25-11-10-15-6-4-5-7-17(15)20(25)12-16(18)8-9-19(22)24(14)2/h4-9,20H,10-13H2,1-3H3 |
| InChIKey | DJHKLYHJNJRRIL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |