C11H18FN2O2 — CID 59898064
CID 59898064 (PubChem CID 59898064) has the molecular formula C11H18FN2O2 and a molecular weight of 229.27 g/mol.
| Compound Name | CID 59898064 |
|---|---|
| PubChem CID | 59898064 |
| Molecular Formula | C11H18FN2O2 |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | — |
| SMILES | C=C(C)NCCC/C(F)=C/[C@@](C)([NH])C(=O)O |
| InChI | InChI=1S/C11H18FN2O2/c1-8(2)14-6-4-5-9(12)7-11(3,13)10(15)16/h7,13-14H,1,4-6H2,2-3H3,(H,15,16)/b9-7-/t11-/m1/s1 |
| InChIKey | DRSWQBUWBLXRFQ-GXMKHXEJSA-N |
| XLogP | 1.87 |
| TPSA | 73.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|