About 7-(3,4-difluorophenyl)spiro[3H-chromene-2,1'-cyclopentane]-4-one
7-(3,4-difluorophenyl)spiro[3H-chromene-2,1'-cyclopentane]-4-one (PubChem CID 59898691) has the molecular formula C19H16F2O2
and a molecular weight of 314.33 g/mol. Its IUPAC name is 7-(3,4-difluorophenyl)spiro[3H-chromene-2,1'-cyclopentane]-4-one.
Molecular Properties
| Compound Name | 7-(3,4-difluorophenyl)spiro[3H-chromene-2,1'-cyclopentane]-4-one |
| PubChem CID | 59898691 |
| Molecular Formula | C19H16F2O2 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 7-(3,4-difluorophenyl)spiro[3H-chromene-2,1'-cyclopentane]-4-one |
| SMILES | O=C1CC2(CCCC2)Oc2cc(-c3ccc(F)c(F)c3)ccc21 |
| InChI | InChI=1S/C19H16F2O2/c20-15-6-4-12(9-16(15)21)13-3-5-14-17(22)11-19(7-1-2-8-19)23-18(14)10-13/h3-6,9-10H,1-2,7-8,11H2 |
| InChIKey | BJRMTCQYHIQYPY-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-(3,4-difluorophenyl)spiro[3H-chromene-2,1'-cyclopentane]-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3,4-difluorophenyl)spiro[3H-chromene-2,1'-cyclopentane]-4-one?
The IUPAC name of 7-(3,4-difluorophenyl)spiro[3H-chromene-2,1'-cyclopentane]-4-one (CID 59898691) is 7-(3,4-difluorophenyl)spiro[3H-chromene-2,1'-cyclopentane]-4-one.
What is the SMILES notation for 7-(3,4-difluorophenyl)spiro[3H-chromene-2,1'-cyclopentane]-4-one?
The canonical SMILES for 7-(3,4-difluorophenyl)spiro[3H-chromene-2,1'-cyclopentane]-4-one is O=C1CC2(CCCC2)Oc2cc(-c3ccc(F)c(F)c3)ccc21.
What is the InChIKey of 7-(3,4-difluorophenyl)spiro[3H-chromene-2,1'-cyclopentane]-4-one?
The InChIKey is BJRMTCQYHIQYPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16F2O2/c20-15-6-4-12(9-16(15)21)13-3-5-14-17(22)11-19(7-1-2-8-19)23-18(14)10-13/h3-6,9-10H,1-2,7-8,11H2.
What are the key properties of 7-(3,4-difluorophenyl)spiro[3H-chromene-2,1'-cyclopentane]-4-one?
7-(3,4-difluorophenyl)spiro[3H-chromene-2,1'-cyclopentane]-4-one has a molecular weight of 314.33 g/mol, XLogP of 4.91, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3,4-difluorophenyl)spiro[3H-chromene-2,1'-cyclopentane]-4-one is sourced from PubChem (CID 59898691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).