C15H16O6 — CID 59903159
[4-(methoxymethoxy)-3-oxo-5-prop-2-enyl-1-benzofuran-6-yl] acetate (PubChem CID 59903159) has the molecular formula C15H16O6 and a molecular weight of 292.29 g/mol. Its IUPAC name is [4-(methoxymethoxy)-3-oxo-5-prop-2-enyl-1-benzofuran-6-yl] acetate.
| Compound Name | [4-(methoxymethoxy)-3-oxo-5-prop-2-enyl-1-benzofuran-6-yl] acetate |
|---|---|
| PubChem CID | 59903159 |
| Molecular Formula | C15H16O6 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | [4-(methoxymethoxy)-3-oxo-5-prop-2-enyl-1-benzofuran-6-yl] acetate |
| SMILES | C=CCc1c(OC(C)=O)cc2c(c1OCOC)C(=O)CO2 |
| InChI | InChI=1S/C15H16O6/c1-4-5-10-12(21-9(2)16)6-13-14(11(17)7-19-13)15(10)20-8-18-3/h4,6H,1,5,7-8H2,2-3H3 |
| InChIKey | WPZBUFKMPLOACC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|