C15H18O5 — CID 53305493
7-(methoxymethoxy)-2,2-dimethyl-5-prop-2-enyl-1,3-benzodioxin-4-one (PubChem CID 53305493) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is 7-(methoxymethoxy)-2,2-dimethyl-5-prop-2-enyl-1,3-benzodioxin-4-one.
| Compound Name | 7-(methoxymethoxy)-2,2-dimethyl-5-prop-2-enyl-1,3-benzodioxin-4-one |
|---|---|
| PubChem CID | 53305493 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 7-(methoxymethoxy)-2,2-dimethyl-5-prop-2-enyl-1,3-benzodioxin-4-one |
| SMILES | C=CCc1cc(OCOC)cc2c1C(=O)OC(C)(C)O2 |
| InChI | InChI=1S/C15H18O5/c1-5-6-10-7-11(18-9-17-4)8-12-13(10)14(16)20-15(2,3)19-12/h5,7-8H,1,6,9H2,2-4H3 |
| InChIKey | ZPEZVUMBUOXGON-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|